C9H8BrF2NO4S — CID 43091467
3-[(2-bromo-4,6-difluorophenyl)sulfonylamino]propanoic acid (PubChem CID 43091467) has the molecular formula C9H8BrF2NO4S and a molecular weight of 344.13 g/mol. Its IUPAC name is 3-[(2-bromo-4,6-difluorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(2-bromo-4,6-difluorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 43091467 |
| Molecular Formula | C9H8BrF2NO4S |
| Molecular Weight | 344.13 g/mol |
| Exact Mass | 342.93 |
| IUPAC Name | 3-[(2-bromo-4,6-difluorophenyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)CCNS(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C9H8BrF2NO4S/c10-6-3-5(11)4-7(12)9(6)18(16,17)13-2-1-8(14)15/h3-4,13H,1-2H2,(H,14,15) |
| InChIKey | ZMOOEJFLEPTSIQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.13 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |