C12H15BrF2N2O2S2 — CID 106326852
2-bromo-4,6-difluoro-N-(2-thiomorpholin-4-ylethyl)benzenesulfonamide (PubChem CID 106326852) has the molecular formula C12H15BrF2N2O2S2 and a molecular weight of 401.30 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-(2-thiomorpholin-4-ylethyl)benzenesulfonamide.
| Compound Name | 2-bromo-4,6-difluoro-N-(2-thiomorpholin-4-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106326852 |
| Molecular Formula | C12H15BrF2N2O2S2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-(2-thiomorpholin-4-ylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCN1CCSCC1)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C12H15BrF2N2O2S2/c13-10-7-9(14)8-11(15)12(10)21(18,19)16-1-2-17-3-5-20-6-4-17/h7-8,16H,1-6H2 |
| InChIKey | PSZUQZISKYIBLO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |