C12H18BrN3O2S2 — CID 106324544
3-amino-4-bromo-N-(2-thiomorpholin-4-ylethyl)benzenesulfonamide (PubChem CID 106324544) has the molecular formula C12H18BrN3O2S2 and a molecular weight of 380.33 g/mol. Its IUPAC name is 3-amino-4-bromo-N-(2-thiomorpholin-4-ylethyl)benzenesulfonamide.
| Compound Name | 3-amino-4-bromo-N-(2-thiomorpholin-4-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106324544 |
| Molecular Formula | C12H18BrN3O2S2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 3-amino-4-bromo-N-(2-thiomorpholin-4-ylethyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCCN2CCSCC2)ccc1Br |
| InChI | InChI=1S/C12H18BrN3O2S2/c13-11-2-1-10(9-12(11)14)20(17,18)15-3-4-16-5-7-19-8-6-16/h1-2,9,15H,3-8,14H2 |
| InChIKey | ISTVWJFKMKAFFE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|