C11H18BrN3O3S2 — CID 106327441
5-(aminomethyl)-2-bromo-N-(2-thiomorpholin-4-ylethyl)furan-3-sulfonamide (PubChem CID 106327441) has the molecular formula C11H18BrN3O3S2 and a molecular weight of 384.32 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-(2-thiomorpholin-4-ylethyl)furan-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-(2-thiomorpholin-4-ylethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106327441 |
| Molecular Formula | C11H18BrN3O3S2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-(2-thiomorpholin-4-ylethyl)furan-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)NCCN2CCSCC2)c(Br)o1 |
| InChI | InChI=1S/C11H18BrN3O3S2/c12-11-10(7-9(8-13)18-11)20(16,17)14-1-2-15-3-5-19-6-4-15/h7,14H,1-6,8,13H2 |
| InChIKey | QXMVHCRCLLBVPM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |