C12H13BrF2N2O3S — CID 115572292
N-[2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]ethyl]cyclopropanecarboxamide (PubChem CID 115572292) has the molecular formula C12H13BrF2N2O3S and a molecular weight of 383.21 g/mol. Its IUPAC name is N-[2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 115572292 |
| Molecular Formula | C12H13BrF2N2O3S |
| Molecular Weight | 383.21 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | N-[2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]ethyl]cyclopropanecarboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1c(F)cc(F)cc1Br)C1CC1 |
| InChI | InChI=1S/C12H13BrF2N2O3S/c13-9-5-8(14)6-10(15)11(9)21(19,20)17-4-3-16-12(18)7-1-2-7/h5-7,17H,1-4H2,(H,16,18) |
| InChIKey | RSCWFKFXBIABBT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|