C12H15BrFN3O3S — CID 116530631
N-[2-[(5-amino-4-bromo-2-fluorophenyl)sulfonylamino]ethyl]cyclopropanecarboxamide (PubChem CID 116530631) has the molecular formula C12H15BrFN3O3S and a molecular weight of 380.24 g/mol. Its IUPAC name is N-[2-[(5-amino-4-bromo-2-fluorophenyl)sulfonylamino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(5-amino-4-bromo-2-fluorophenyl)sulfonylamino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 116530631 |
| Molecular Formula | C12H15BrFN3O3S |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | N-[2-[(5-amino-4-bromo-2-fluorophenyl)sulfonylamino]ethyl]cyclopropanecarboxamide |
| SMILES | Nc1cc(S(=O)(=O)NCCNC(=O)C2CC2)c(F)cc1Br |
| InChI | InChI=1S/C12H15BrFN3O3S/c13-8-5-9(14)11(6-10(8)15)21(19,20)17-4-3-16-12(18)7-1-2-7/h5-7,17H,1-4,15H2,(H,16,18) |
| InChIKey | RVYZGOCHEYSZQT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|