C11H14BrFN2O4S2 — CID 116529819
5-amino-4-bromo-N-(1,1-dioxothian-4-yl)-2-fluorobenzenesulfonamide (PubChem CID 116529819) has the molecular formula C11H14BrFN2O4S2 and a molecular weight of 401.28 g/mol. Its IUPAC name is 5-amino-4-bromo-N-(1,1-dioxothian-4-yl)-2-fluorobenzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N-(1,1-dioxothian-4-yl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 116529819 |
| Molecular Formula | C11H14BrFN2O4S2 |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | 5-amino-4-bromo-N-(1,1-dioxothian-4-yl)-2-fluorobenzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NC2CCS(=O)(=O)CC2)c(F)cc1Br |
| InChI | InChI=1S/C11H14BrFN2O4S2/c12-8-5-9(13)11(6-10(8)14)21(18,19)15-7-1-3-20(16,17)4-2-7/h5-7,15H,1-4,14H2 |
| InChIKey | MYOBXIGZMCMTCL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|