C12H17BrN2O4S2 — CID 114625209
5-amino-4-bromo-N-(1,1-dioxothian-4-yl)-2-methylbenzenesulfonamide (PubChem CID 114625209) has the molecular formula C12H17BrN2O4S2 and a molecular weight of 397.32 g/mol. Its IUPAC name is 5-amino-4-bromo-N-(1,1-dioxothian-4-yl)-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N-(1,1-dioxothian-4-yl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114625209 |
| Molecular Formula | C12H17BrN2O4S2 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 5-amino-4-bromo-N-(1,1-dioxothian-4-yl)-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(N)cc1S(=O)(=O)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H17BrN2O4S2/c1-8-6-10(13)11(14)7-12(8)21(18,19)15-9-2-4-20(16,17)5-3-9/h6-7,9,15H,2-5,14H2,1H3 |
| InChIKey | GHZYKBGVIKRFRO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|