C12H16BrFN2O3S — CID 114464970
5-amino-4-bromo-2-fluoro-N-[2-(2-methylprop-2-enoxy)ethyl]benzenesulfonamide (PubChem CID 114464970) has the molecular formula C12H16BrFN2O3S and a molecular weight of 367.24 g/mol. Its IUPAC name is 5-amino-4-bromo-2-fluoro-N-[2-(2-methylprop-2-enoxy)ethyl]benzenesulfonamide.
| Compound Name | 5-amino-4-bromo-2-fluoro-N-[2-(2-methylprop-2-enoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 114464970 |
| Molecular Formula | C12H16BrFN2O3S |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 5-amino-4-bromo-2-fluoro-N-[2-(2-methylprop-2-enoxy)ethyl]benzenesulfonamide |
| SMILES | C=C(C)COCCNS(=O)(=O)c1cc(N)c(Br)cc1F |
| InChI | InChI=1S/C12H16BrFN2O3S/c1-8(2)7-19-4-3-16-20(17,18)12-6-11(15)9(13)5-10(12)14/h5-6,16H,1,3-4,7,15H2,2H3 |
| InChIKey | GJUUFAMOXRITMN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|