C9H9BrF2N2O4S — CID 83203648
2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]ethyl carbamate (PubChem CID 83203648) has the molecular formula C9H9BrF2N2O4S and a molecular weight of 359.15 g/mol. Its IUPAC name is 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]ethyl carbamate.
| Compound Name | 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83203648 |
| Molecular Formula | C9H9BrF2N2O4S |
| Molecular Weight | 359.15 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]ethyl carbamate |
| SMILES | NC(=O)OCCNS(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C9H9BrF2N2O4S/c10-6-3-5(11)4-7(12)8(6)19(16,17)14-1-2-18-9(13)15/h3-4,14H,1-2H2,(H2,13,15) |
| InChIKey | DGNBCGHYEZPFBJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.15 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|