C13H19ClO3S — CID 87865899
6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol (PubChem CID 87865899) has the molecular formula C13H19ClO3S and a molecular weight of 290.81 g/mol. Its IUPAC name is 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol.
| Compound Name | 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol |
|---|---|
| PubChem CID | 87865899 |
| Molecular Formula | C13H19ClO3S |
| Molecular Weight | 290.81 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1S(=O)(=O)CCl |
| InChI | InChI=1S/C13H19ClO3S/c1-8-6-10(13(3,4)5)11(15)9(2)12(8)18(16,17)7-14/h6,15H,7H2,1-5H3 |
| InChIKey | SYHVRTXQUIAYGM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|