About 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol
6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol (PubChem CID 87865899) has the molecular formula C13H19ClO3S
and a molecular weight of 290.81 g/mol. Its IUPAC name is 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol.
Molecular Properties
| Compound Name | 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol |
| PubChem CID | 87865899 |
| Molecular Formula | C13H19ClO3S |
| Molecular Weight | 290.81 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1S(=O)(=O)CCl |
| InChI | InChI=1S/C13H19ClO3S/c1-8-6-10(13(3,4)5)11(15)9(2)12(8)18(16,17)7-14/h6,15H,7H2,1-5H3 |
| InChIKey | SYHVRTXQUIAYGM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol?
The IUPAC name of 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol (CID 87865899) is 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol.
What is the SMILES notation for 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol?
The canonical SMILES for 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol is Cc1cc(C(C)(C)C)c(O)c(C)c1S(=O)(=O)CCl.
What is the InChIKey of 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol?
The InChIKey is SYHVRTXQUIAYGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClO3S/c1-8-6-10(13(3,4)5)11(15)9(2)12(8)18(16,17)7-14/h6,15H,7H2,1-5H3.
What are the key properties of 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol?
6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol has a molecular weight of 290.81 g/mol, XLogP of 3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-3-(chloromethylsulfonyl)-2,4-dimethylphenol is sourced from PubChem (CID 87865899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).