C55H79O8P — CID 118527861
[2-[2-bis(2,4-ditert-butylphenoxy)phosphanyloxy-3-tert-butyl-5-methoxyphenyl]-6-tert-butyl-4-methoxyphenyl] tert-butyl carbonate (PubChem CID 118527861) has the molecular formula C55H79O8P and a molecular weight of 899.20 g/mol. Its IUPAC name is [2-[2-bis(2,4-ditert-butylphenoxy)phosphanyloxy-3-tert-butyl-5-methoxyphenyl]-6-tert-butyl-4-methoxyphenyl] tert-butyl carbonate.
| Compound Name | [2-[2-bis(2,4-ditert-butylphenoxy)phosphanyloxy-3-tert-butyl-5-methoxyphenyl]-6-tert-butyl-4-methoxyphenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 118527861 |
| Molecular Formula | C55H79O8P |
| Molecular Weight | 899.20 g/mol |
| Exact Mass | 898.55 |
| IUPAC Name | [2-[2-bis(2,4-ditert-butylphenoxy)phosphanyloxy-3-tert-butyl-5-methoxyphenyl]-6-tert-butyl-4-methoxyphenyl] tert-butyl carbonate |
| SMILES | COc1cc(-c2cc(OC)cc(C(C)(C)C)c2OP(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c(OC(=O)OC(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C55H79O8P/c1-49(2,3)34-24-26-44(40(28-34)51(7,8)9)61-64(62-45-27-25-35(50(4,5)6)29-41(45)52(10,11)12)63-47-39(31-37(58-23)33-43(47)54(16,17)18)38-30-36(57-22)32-42(53(13,14)15)46(38)59-48(56)60-55(19,20)21/h24-33H,1-23H3 |
| InChIKey | SHMVTYWKNQDXQN-UHFFFAOYSA-N |
| XLogP | 16.23 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.20 |
| LogP ≤ 5 | 16.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|