C51H81O6P3 — CID 23320532
2,4,6-tris(2,6-ditert-butyl-4-propylphenoxy)-1,3,5,2,4,6-trioxatriphosphinane (PubChem CID 23320532) has the molecular formula C51H81O6P3 and a molecular weight of 883.12 g/mol. Its IUPAC name is 2,4,6-tris(2,6-ditert-butyl-4-propylphenoxy)-1,3,5,2,4,6-trioxatriphosphinane.
| Compound Name | 2,4,6-tris(2,6-ditert-butyl-4-propylphenoxy)-1,3,5,2,4,6-trioxatriphosphinane |
|---|---|
| PubChem CID | 23320532 |
| Molecular Formula | C51H81O6P3 |
| Molecular Weight | 883.12 g/mol |
| Exact Mass | 882.52 |
| IUPAC Name | 2,4,6-tris(2,6-ditert-butyl-4-propylphenoxy)-1,3,5,2,4,6-trioxatriphosphinane |
| SMILES | CCCc1cc(C(C)(C)C)c(OP2OP(Oc3c(C(C)(C)C)cc(CCC)cc3C(C)(C)C)OP(Oc3c(C(C)(C)C)cc(CCC)cc3C(C)(C)C)O2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C51H81O6P3/c1-22-25-34-28-37(46(4,5)6)43(38(29-34)47(7,8)9)52-58-55-59(53-44-39(48(10,11)12)30-35(26-23-2)31-40(44)49(13,14)15)57-60(56-58)54-45-41(50(16,17)18)32-36(27-24-3)33-42(45)51(19,20)21/h28-33H,22-27H2,1-21H3 |
| InChIKey | JZVVJLLWDKQPMT-UHFFFAOYSA-N |
| XLogP | 17.61 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.12 |
| LogP ≤ 5 | 17.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|