C27H45O5P — CID 58856269
methyl 3-[3,5-ditert-butyl-4-[(5-butyl-5-ethyl-1,3,2-dioxaphosphinan-2-yl)oxy]phenyl]propanoate (PubChem CID 58856269) has the molecular formula C27H45O5P and a molecular weight of 480.63 g/mol. Its IUPAC name is methyl 3-[3,5-ditert-butyl-4-[(5-butyl-5-ethyl-1,3,2-dioxaphosphinan-2-yl)oxy]phenyl]propanoate.
| Compound Name | methyl 3-[3,5-ditert-butyl-4-[(5-butyl-5-ethyl-1,3,2-dioxaphosphinan-2-yl)oxy]phenyl]propanoate |
|---|---|
| PubChem CID | 58856269 |
| Molecular Formula | C27H45O5P |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | methyl 3-[3,5-ditert-butyl-4-[(5-butyl-5-ethyl-1,3,2-dioxaphosphinan-2-yl)oxy]phenyl]propanoate |
| SMILES | CCCCC1(CC)COP(Oc2c(C(C)(C)C)cc(CCC(=O)OC)cc2C(C)(C)C)OC1 |
| InChI | InChI=1S/C27H45O5P/c1-10-12-15-27(11-2)18-30-33(31-19-27)32-24-21(25(3,4)5)16-20(13-14-23(28)29-9)17-22(24)26(6,7)8/h16-17H,10-15,18-19H2,1-9H3 |
| InChIKey | WNWZACJQNSSAAV-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|