C33H38O5 — CID 131966908
methyl 3-[3,5-ditert-butyl-4-(9H-fluoren-9-ylmethoxycarbonyloxy)phenyl]propanoate (PubChem CID 131966908) has the molecular formula C33H38O5 and a molecular weight of 514.66 g/mol. Its IUPAC name is methyl 3-[3,5-ditert-butyl-4-(9H-fluoren-9-ylmethoxycarbonyloxy)phenyl]propanoate.
| Compound Name | methyl 3-[3,5-ditert-butyl-4-(9H-fluoren-9-ylmethoxycarbonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 131966908 |
| Molecular Formula | C33H38O5 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | methyl 3-[3,5-ditert-butyl-4-(9H-fluoren-9-ylmethoxycarbonyloxy)phenyl]propanoate |
| SMILES | COC(=O)CCc1cc(C(C)(C)C)c(OC(=O)OCC2c3ccccc3-c3ccccc32)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H38O5/c1-32(2,3)27-18-21(16-17-29(34)36-7)19-28(33(4,5)6)30(27)38-31(35)37-20-26-24-14-10-8-12-22(24)23-13-9-11-15-25(23)26/h8-15,18-19,26H,16-17,20H2,1-7H3 |
| InChIKey | JRVHOGXSFQODGH-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|