C22H34O — CID 83938672
1,3-ditert-butyl-5-pent-3-ynyl-2-propoxybenzene (PubChem CID 83938672) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-pent-3-ynyl-2-propoxybenzene.
| Compound Name | 1,3-ditert-butyl-5-pent-3-ynyl-2-propoxybenzene |
|---|---|
| PubChem CID | 83938672 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 1,3-ditert-butyl-5-pent-3-ynyl-2-propoxybenzene |
| SMILES | CC#CCCc1cc(C(C)(C)C)c(OCCC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H34O/c1-9-11-12-13-17-15-18(21(3,4)5)20(23-14-10-2)19(16-17)22(6,7)8/h15-16H,10,12-14H2,1-8H3 |
| InChIKey | GZANTYDSHLOIIP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|