C25H35O2P — CID 56627500
2-(2,4,6-tritert-butylphenoxy)-3H-1,2-benzoxaphosphole (PubChem CID 56627500) has the molecular formula C25H35O2P and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-(2,4,6-tritert-butylphenoxy)-3H-1,2-benzoxaphosphole.
| Compound Name | 2-(2,4,6-tritert-butylphenoxy)-3H-1,2-benzoxaphosphole |
|---|---|
| PubChem CID | 56627500 |
| Molecular Formula | C25H35O2P |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 2-(2,4,6-tritert-butylphenoxy)-3H-1,2-benzoxaphosphole |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(OP2Cc3ccccc3O2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H35O2P/c1-23(2,3)18-14-19(24(4,5)6)22(20(15-18)25(7,8)9)27-28-16-17-12-10-11-13-21(17)26-28/h10-15H,16H2,1-9H3 |
| InChIKey | AVUOHRDWLYXCMG-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|