C26H37O2P — CID 56620541
7-tert-butyl-2-(2,6-ditert-butyl-4-methylphenoxy)-3H-1,2-benzoxaphosphole (PubChem CID 56620541) has the molecular formula C26H37O2P and a molecular weight of 412.55 g/mol. Its IUPAC name is 7-tert-butyl-2-(2,6-ditert-butyl-4-methylphenoxy)-3H-1,2-benzoxaphosphole.
| Compound Name | 7-tert-butyl-2-(2,6-ditert-butyl-4-methylphenoxy)-3H-1,2-benzoxaphosphole |
|---|---|
| PubChem CID | 56620541 |
| Molecular Formula | C26H37O2P |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 7-tert-butyl-2-(2,6-ditert-butyl-4-methylphenoxy)-3H-1,2-benzoxaphosphole |
| SMILES | Cc1cc(C(C)(C)C)c(OP2Cc3cccc(C(C)(C)C)c3O2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H37O2P/c1-17-14-20(25(5,6)7)23(21(15-17)26(8,9)10)28-29-16-18-12-11-13-19(22(18)27-29)24(2,3)4/h11-15H,16H2,1-10H3 |
| InChIKey | LBMPIILJEKSVBI-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|