C27H40NO2P — CID 631871
1,9-ditert-butyl-N,N-diethyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-amine (PubChem CID 631871) has the molecular formula C27H40NO2P and a molecular weight of 441.60 g/mol. Its IUPAC name is 1,9-ditert-butyl-N,N-diethyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-amine.
| Compound Name | 1,9-ditert-butyl-N,N-diethyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-amine |
|---|---|
| PubChem CID | 631871 |
| Molecular Formula | C27H40NO2P |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | 1,9-ditert-butyl-N,N-diethyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-amine |
| SMILES | CCN(CC)P1Oc2c(cc(C)cc2C(C)(C)C)Cc2cc(C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C27H40NO2P/c1-11-28(12-2)31-29-24-20(13-18(3)15-22(24)26(5,6)7)17-21-14-19(4)16-23(25(21)30-31)27(8,9)10/h13-16H,11-12,17H2,1-10H3 |
| InChIKey | NRGOJRVWTVSCJH-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|