C23H30O2PS+ — CID 6365061
1,9-ditert-butyl-3,7-dimethyl-11-sulfanylidene-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-ium (PubChem CID 6365061) has the molecular formula C23H30O2PS+ and a molecular weight of 401.53 g/mol. Its IUPAC name is 1,9-ditert-butyl-3,7-dimethyl-11-sulfanylidene-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-ium.
| Compound Name | 1,9-ditert-butyl-3,7-dimethyl-11-sulfanylidene-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-ium |
|---|---|
| PubChem CID | 6365061 |
| Molecular Formula | C23H30O2PS+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1,9-ditert-butyl-3,7-dimethyl-11-sulfanylidene-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-ium |
| SMILES | Cc1cc2c(c(C(C)(C)C)c1)O[P+](=S)Oc1c(cc(C)cc1C(C)(C)C)C2 |
| InChI | InChI=1S/C23H30O2PS/c1-14-9-16-13-17-10-15(2)12-19(23(6,7)8)21(17)25-26(27)24-20(16)18(11-14)22(3,4)5/h9-12H,13H2,1-8H3/q+1 |
| InChIKey | ZISNEEGBEDBPOC-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|