C37H51NO3Si — CID 101105136
4,16,21-tritert-butyl-1,6,14,23-tetramethyl-2,18,19-trioxa-10-aza-1-silapentacyclo[8.8.8.03,8.012,17.020,25]hexacosa-3(8),4,6,12(17),13,15,20(25),21,23-nonaene (PubChem CID 101105136) has the molecular formula C37H51NO3Si and a molecular weight of 585.91 g/mol. Its IUPAC name is 4,16,21-tritert-butyl-1,6,14,23-tetramethyl-2,18,19-trioxa-10-aza-1-silapentacyclo[8.8.8.03,8.012,17.020,25]hexacosa-3(8),4,6,12(17),13,15,20(25),21,23-nonaene.
| Compound Name | 4,16,21-tritert-butyl-1,6,14,23-tetramethyl-2,18,19-trioxa-10-aza-1-silapentacyclo[8.8.8.03,8.012,17.020,25]hexacosa-3(8),4,6,12(17),13,15,20(25),21,23-nonaene |
|---|---|
| PubChem CID | 101105136 |
| Molecular Formula | C37H51NO3Si |
| Molecular Weight | 585.91 g/mol |
| Exact Mass | 585.36 |
| IUPAC Name | 4,16,21-tritert-butyl-1,6,14,23-tetramethyl-2,18,19-trioxa-10-aza-1-silapentacyclo[8.8.8.03,8.012,17.020,25]hexacosa-3(8),4,6,12(17),13,15,20(25),21,23-nonaene |
| SMILES | Cc1cc2c(c(C(C)(C)C)c1)O[Si]1(C)Oc3c(cc(C)cc3C(C)(C)C)CN(C2)Cc2cc(C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C37H51NO3Si/c1-23-14-26-20-38-21-27-15-24(2)18-30(36(7,8)9)33(27)40-42(13,39-32(26)29(17-23)35(4,5)6)41-34-28(22-38)16-25(3)19-31(34)37(10,11)12/h14-19H,20-22H2,1-13H3 |
| InChIKey | DLXFZZHJOVFPCM-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.91 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|