C42H54NO3P — CID 23419871
2-tert-butyl-6-[(6,18-ditert-butyl-8,16-dimethyl-3-phenyl-2,4-dioxa-12-aza-3-phosphatricyclo[12.4.0.05,10]octadeca-1(14),5(10),6,8,15,17-hexaen-12-yl)methyl]-4-methylphenol (PubChem CID 23419871) has the molecular formula C42H54NO3P and a molecular weight of 651.87 g/mol. Its IUPAC name is 2-tert-butyl-6-[(6,18-ditert-butyl-8,16-dimethyl-3-phenyl-2,4-dioxa-12-aza-3-phosphatricyclo[12.4.0.05,10]octadeca-1(14),5(10),6,8,15,17-hexaen-12-yl)methyl]-4-methylphenol.
| Compound Name | 2-tert-butyl-6-[(6,18-ditert-butyl-8,16-dimethyl-3-phenyl-2,4-dioxa-12-aza-3-phosphatricyclo[12.4.0.05,10]octadeca-1(14),5(10),6,8,15,17-hexaen-12-yl)methyl]-4-methylphenol |
|---|---|
| PubChem CID | 23419871 |
| Molecular Formula | C42H54NO3P |
| Molecular Weight | 651.87 g/mol |
| Exact Mass | 651.38 |
| IUPAC Name | 2-tert-butyl-6-[(6,18-ditert-butyl-8,16-dimethyl-3-phenyl-2,4-dioxa-12-aza-3-phosphatricyclo[12.4.0.05,10]octadeca-1(14),5(10),6,8,15,17-hexaen-12-yl)methyl]-4-methylphenol |
| SMILES | Cc1cc(CN2Cc3cc(C)cc(C(C)(C)C)c3OP(c3ccccc3)Oc3c(cc(C)cc3C(C)(C)C)C2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H54NO3P/c1-27-18-30(37(44)34(21-27)40(4,5)6)24-43-25-31-19-28(2)22-35(41(7,8)9)38(31)45-47(33-16-14-13-15-17-33)46-39-32(26-43)20-29(3)23-36(39)42(10,11)12/h13-23,44H,24-26H2,1-12H3 |
| InChIKey | ZEWXLYKMPJYDLT-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.87 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|