C22H28O3P+ — CID 21130891
4,8-ditert-butyl-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepin-6-ium 6-oxide (PubChem CID 21130891) has the molecular formula C22H28O3P+ and a molecular weight of 371.44 g/mol. Its IUPAC name is 4,8-ditert-butyl-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepin-6-ium 6-oxide.
| Compound Name | 4,8-ditert-butyl-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepin-6-ium 6-oxide |
|---|---|
| PubChem CID | 21130891 |
| Molecular Formula | C22H28O3P+ |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 4,8-ditert-butyl-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepin-6-ium 6-oxide |
| SMILES | Cc1cc2c(c(C(C)(C)C)c1)O[P+](=O)Oc1c-2cc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C22H28O3P/c1-13-9-15-16-10-14(2)12-18(22(6,7)8)20(16)25-26(23)24-19(15)17(11-13)21(3,4)5/h9-12H,1-8H3/q+1 |
| InChIKey | KTCOZAMOVWEDLE-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|