C23H28O2Se — CID 139266105
6,12-ditert-butyl-4,14-dimethyl-8,10-dioxa-9λ4-selenatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11(16),12,14-heptaene (PubChem CID 139266105) has the molecular formula C23H28O2Se and a molecular weight of 415.44 g/mol. Its IUPAC name is 6,12-ditert-butyl-4,14-dimethyl-8,10-dioxa-9λ4-selenatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11(16),12,14-heptaene.
| Compound Name | 6,12-ditert-butyl-4,14-dimethyl-8,10-dioxa-9λ4-selenatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11(16),12,14-heptaene |
|---|---|
| PubChem CID | 139266105 |
| Molecular Formula | C23H28O2Se |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 6,12-ditert-butyl-4,14-dimethyl-8,10-dioxa-9λ4-selenatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11(16),12,14-heptaene |
| SMILES | Cc1cc2c(c(C(C)(C)C)c1)O[Se]1=C2c2cc(C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C23H28O2Se/c1-13-9-15-19(17(11-13)22(3,4)5)24-26-21(15)16-10-14(2)12-18(20(16)25-26)23(6,7)8/h9-12H,1-8H3 |
| InChIKey | SEEKKKLPRSFVHB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|