C24H28O2 — CID 11739540
3,10-ditert-butyl-7,14-dimethyl-5,12-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,6,8,10,13,15-heptaene (PubChem CID 11739540) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 3,10-ditert-butyl-7,14-dimethyl-5,12-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,6,8,10,13,15-heptaene.
| Compound Name | 3,10-ditert-butyl-7,14-dimethyl-5,12-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,6,8,10,13,15-heptaene |
|---|---|
| PubChem CID | 11739540 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 3,10-ditert-butyl-7,14-dimethyl-5,12-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,6,8,10,13,15-heptaene |
| SMILES | CC1=COc2c(C(C)(C)C)cc3c4c(c(C(C)(C)C)cc1c24)OC=C3C |
| InChI | InChI=1S/C24H28O2/c1-13-11-25-21-18(24(6,7)8)10-16-14(2)12-26-22-17(23(3,4)5)9-15(13)19(21)20(16)22/h9-12H,1-8H3 |
| InChIKey | WTROWJKSCOUDLZ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |