C33H51N2O2P — CID 22909918
N-(1,9-ditert-butyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)-1,2,2,6,6-pentamethylpiperidin-4-amine (PubChem CID 22909918) has the molecular formula C33H51N2O2P and a molecular weight of 538.76 g/mol. Its IUPAC name is N-(1,9-ditert-butyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)-1,2,2,6,6-pentamethylpiperidin-4-amine.
| Compound Name | N-(1,9-ditert-butyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)-1,2,2,6,6-pentamethylpiperidin-4-amine |
|---|---|
| PubChem CID | 22909918 |
| Molecular Formula | C33H51N2O2P |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.37 |
| IUPAC Name | N-(1,9-ditert-butyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)-1,2,2,6,6-pentamethylpiperidin-4-amine |
| SMILES | Cc1cc2c(c(C(C)(C)C)c1)OP(NC1CC(C)(C)N(C)C(C)(C)C1)Oc1c(cc(C)cc1C(C)(C)C)C2 |
| InChI | InChI=1S/C33H51N2O2P/c1-21-14-23-18-24-15-22(2)17-27(31(6,7)8)29(24)37-38(36-28(23)26(16-21)30(3,4)5)34-25-19-32(9,10)35(13)33(11,12)20-25/h14-17,25,34H,18-20H2,1-13H3 |
| InChIKey | MEQIDBIMPFIBNF-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|