C29H41O2P — CID 172720375
1,9-ditert-butyl-11-cyclohexyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine (PubChem CID 172720375) has the molecular formula C29H41O2P and a molecular weight of 452.62 g/mol. Its IUPAC name is 1,9-ditert-butyl-11-cyclohexyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine.
| Compound Name | 1,9-ditert-butyl-11-cyclohexyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine |
|---|---|
| PubChem CID | 172720375 |
| Molecular Formula | C29H41O2P |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 1,9-ditert-butyl-11-cyclohexyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine |
| SMILES | Cc1cc2c(c(C(C)(C)C)c1)OP(C1CCCCC1)Oc1c(cc(C)cc1C(C)(C)C)C2 |
| InChI | InChI=1S/C29H41O2P/c1-19-14-21-18-22-15-20(2)17-25(29(6,7)8)27(22)31-32(23-12-10-9-11-13-23)30-26(21)24(16-19)28(3,4)5/h14-17,23H,9-13,18H2,1-8H3 |
| InChIKey | GKUWVWCIBGSHFO-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|