C38H53O2P — CID 23454640
6-[2-tert-butyl-4,6-bis(2-methylheptan-2-yl)phenoxy]benzo[c][2,1]benzoxaphosphinine (PubChem CID 23454640) has the molecular formula C38H53O2P and a molecular weight of 572.81 g/mol. Its IUPAC name is 6-[2-tert-butyl-4,6-bis(2-methylheptan-2-yl)phenoxy]benzo[c][2,1]benzoxaphosphinine.
| Compound Name | 6-[2-tert-butyl-4,6-bis(2-methylheptan-2-yl)phenoxy]benzo[c][2,1]benzoxaphosphinine |
|---|---|
| PubChem CID | 23454640 |
| Molecular Formula | C38H53O2P |
| Molecular Weight | 572.81 g/mol |
| Exact Mass | 572.38 |
| IUPAC Name | 6-[2-tert-butyl-4,6-bis(2-methylheptan-2-yl)phenoxy]benzo[c][2,1]benzoxaphosphinine |
| SMILES | CCCCCC(C)(C)c1cc(C(C)(C)C)c(OP2Oc3ccccc3-c3ccccc32)c(C(C)(C)CCCCC)c1 |
| InChI | InChI=1S/C38H53O2P/c1-10-12-18-24-37(6,7)28-26-31(36(3,4)5)35(32(27-28)38(8,9)25-19-13-11-2)40-41-34-23-17-15-21-30(34)29-20-14-16-22-33(29)39-41/h14-17,20-23,26-27H,10-13,18-19,24-25H2,1-9H3 |
| InChIKey | FKPBOCUQLFXTGY-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.81 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|