C26H29O2P — CID 20673828
3,8-ditert-butyl-6-phenoxybenzo[c][2,1]benzoxaphosphinine (PubChem CID 20673828) has the molecular formula C26H29O2P and a molecular weight of 404.49 g/mol. Its IUPAC name is 3,8-ditert-butyl-6-phenoxybenzo[c][2,1]benzoxaphosphinine.
| Compound Name | 3,8-ditert-butyl-6-phenoxybenzo[c][2,1]benzoxaphosphinine |
|---|---|
| PubChem CID | 20673828 |
| Molecular Formula | C26H29O2P |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 3,8-ditert-butyl-6-phenoxybenzo[c][2,1]benzoxaphosphinine |
| SMILES | CC(C)(C)c1ccc2c(c1)OP(Oc1ccccc1)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C26H29O2P/c1-25(2,3)18-12-14-21-22-15-13-19(26(4,5)6)17-24(22)29(28-23(21)16-18)27-20-10-8-7-9-11-20/h7-17H,1-6H3 |
| InChIKey | NWTWEEKKTWFAHQ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|