C21H17O4P — CID 57001362
benzo[c][2,1]benzoxaphosphinin-6-yl-(3,5-dimethoxyphenyl)methanone (PubChem CID 57001362) has the molecular formula C21H17O4P and a molecular weight of 364.34 g/mol. Its IUPAC name is benzo[c][2,1]benzoxaphosphinin-6-yl-(3,5-dimethoxyphenyl)methanone.
| Compound Name | benzo[c][2,1]benzoxaphosphinin-6-yl-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 57001362 |
| Molecular Formula | C21H17O4P |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | benzo[c][2,1]benzoxaphosphinin-6-yl-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)P2Oc3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C21H17O4P/c1-23-15-11-14(12-16(13-15)24-2)21(22)26-20-10-6-4-8-18(20)17-7-3-5-9-19(17)25-26/h3-13H,1-2H3 |
| InChIKey | JFQUDSNEEYQOSQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|