About bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate
bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate (PubChem CID 66645438) has the molecular formula C33H30O9
and a molecular weight of 570.59 g/mol. Its IUPAC name is bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate.
Molecular Properties
| Compound Name | bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate |
| PubChem CID | 66645438 |
| Molecular Formula | C33H30O9 |
| Molecular Weight | 570.59 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate |
| SMILES | COc1cc(OC)cc(C(=O)C(OC(=O)OC(C(=O)c2cc(OC)cc(OC)c2)c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C33H30O9/c1-37-25-15-23(16-26(19-25)38-2)29(34)31(21-11-7-5-8-12-21)41-33(36)42-32(22-13-9-6-10-14-22)30(35)24-17-27(39-3)20-28(18-24)40-4/h5-20,31-32H,1-4H3 |
| InChIKey | XWMOEWHEZZEFNC-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate?
The IUPAC name of bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate (CID 66645438) is bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate.
What is the SMILES notation for bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate?
The canonical SMILES for bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate is COc1cc(OC)cc(C(=O)C(OC(=O)OC(C(=O)c2cc(OC)cc(OC)c2)c2ccccc2)c2ccccc2)c1.
What is the InChIKey of bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate?
The InChIKey is XWMOEWHEZZEFNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H30O9/c1-37-25-15-23(16-26(19-25)38-2)29(34)31(21-11-7-5-8-12-21)41-33(36)42-32(22-13-9-6-10-14-22)30(35)24-17-27(39-3)20-28(18-24)40-4/h5-20,31-32H,1-4H3.
What are the key properties of bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate?
bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate has a molecular weight of 570.59 g/mol, XLogP of 6.42, 12 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(3,5-dimethoxyphenyl)-2-oxo-1-phenylethyl] carbonate is sourced from PubChem (CID 66645438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).