C29H47O3P — CID 90750737
(2-tert-butyl-4-methylphenyl) (2,4-ditert-butylphenyl) methyl phosphite;propane (PubChem CID 90750737) has the molecular formula C29H47O3P and a molecular weight of 474.67 g/mol. Its IUPAC name is (2-tert-butyl-4-methylphenyl) (2,4-ditert-butylphenyl) methyl phosphite;propane.
| Compound Name | (2-tert-butyl-4-methylphenyl) (2,4-ditert-butylphenyl) methyl phosphite;propane |
|---|---|
| PubChem CID | 90750737 |
| Molecular Formula | C29H47O3P |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | (2-tert-butyl-4-methylphenyl) (2,4-ditert-butylphenyl) methyl phosphite;propane |
| SMILES | CCC.COP(Oc1ccc(C)cc1C(C)(C)C)Oc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C26H39O3P.C3H8/c1-18-12-14-22(20(16-18)25(5,6)7)28-30(27-11)29-23-15-13-19(24(2,3)4)17-21(23)26(8,9)10;1-3-2/h12-17H,1-11H3;3H2,1-2H3 |
| InChIKey | BHRRGTKCLRTNBU-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|