C17H28O — CID 159915288
[(3S)-7-methoxy-2,2,3-trimethylheptan-3-yl]benzene (PubChem CID 159915288) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is [(3S)-7-methoxy-2,2,3-trimethylheptan-3-yl]benzene.
| Compound Name | [(3S)-7-methoxy-2,2,3-trimethylheptan-3-yl]benzene |
|---|---|
| PubChem CID | 159915288 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | [(3S)-7-methoxy-2,2,3-trimethylheptan-3-yl]benzene |
| SMILES | COCCCC[C@](C)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C17H28O/c1-16(2,3)17(4,13-9-10-14-18-5)15-11-7-6-8-12-15/h6-8,11-12H,9-10,13-14H2,1-5H3/t17-/m1/s1 |
| InChIKey | IXXQSIRMMYACCP-QGZVFWFLSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|