C15H18OSi — CID 173081821
1,1-diphenylethyl(methoxy)silane (PubChem CID 173081821) has the molecular formula C15H18OSi and a molecular weight of 242.39 g/mol. Its IUPAC name is 1,1-diphenylethyl(methoxy)silane.
| Compound Name | 1,1-diphenylethyl(methoxy)silane |
|---|---|
| PubChem CID | 173081821 |
| Molecular Formula | C15H18OSi |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1,1-diphenylethyl(methoxy)silane |
| SMILES | CO[SiH2]C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H18OSi/c1-15(17-16-2,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,17H2,1-2H3 |
| InChIKey | PVJOGBULXNSHOI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|