C24H24ClNO — CID 52997639
4-[benzyl(methyl)amino]-1,1-diphenylbut-2-yn-1-ol;hydrochloride (PubChem CID 52997639) has the molecular formula C24H24ClNO and a molecular weight of 377.92 g/mol. Its IUPAC name is 4-[benzyl(methyl)amino]-1,1-diphenylbut-2-yn-1-ol;hydrochloride.
| Compound Name | 4-[benzyl(methyl)amino]-1,1-diphenylbut-2-yn-1-ol;hydrochloride |
|---|---|
| PubChem CID | 52997639 |
| Molecular Formula | C24H24ClNO |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-[benzyl(methyl)amino]-1,1-diphenylbut-2-yn-1-ol;hydrochloride |
| SMILES | CN(CC#CC(O)(c1ccccc1)c1ccccc1)Cc1ccccc1.Cl |
| InChI | InChI=1S/C24H23NO.ClH/c1-25(20-21-12-5-2-6-13-21)19-11-18-24(26,22-14-7-3-8-15-22)23-16-9-4-10-17-23;/h2-10,12-17,26H,19-20H2,1H3;1H |
| InChIKey | ONBGBRKYGRAINR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|