C26H28N2 — CID 155934629
(1S)-N,N'-dibenzyl-N,N'-dimethyl-1-phenylbut-2-yne-1,4-diamine (PubChem CID 155934629) has the molecular formula C26H28N2 and a molecular weight of 368.52 g/mol. Its IUPAC name is (1S)-N,N'-dibenzyl-N,N'-dimethyl-1-phenylbut-2-yne-1,4-diamine.
| Compound Name | (1S)-N,N'-dibenzyl-N,N'-dimethyl-1-phenylbut-2-yne-1,4-diamine |
|---|---|
| PubChem CID | 155934629 |
| Molecular Formula | C26H28N2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | (1S)-N,N'-dibenzyl-N,N'-dimethyl-1-phenylbut-2-yne-1,4-diamine |
| SMILES | CN(CC#C[C@H](c1ccccc1)N(C)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H28N2/c1-27(21-23-13-6-3-7-14-23)20-12-19-26(25-17-10-5-11-18-25)28(2)22-24-15-8-4-9-16-24/h3-11,13-18,26H,20-22H2,1-2H3/t26-/m1/s1 |
| InChIKey | GWNIRSWYPPAOIW-AREMUKBSSA-N |
| XLogP | 5.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|