C17H25N — CID 171598906
N,4-dimethyl-N-[(4-propan-2-ylphenyl)methyl]pent-2-yn-1-amine (PubChem CID 171598906) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is N,4-dimethyl-N-[(4-propan-2-ylphenyl)methyl]pent-2-yn-1-amine.
| Compound Name | N,4-dimethyl-N-[(4-propan-2-ylphenyl)methyl]pent-2-yn-1-amine |
|---|---|
| PubChem CID | 171598906 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | N,4-dimethyl-N-[(4-propan-2-ylphenyl)methyl]pent-2-yn-1-amine |
| SMILES | CC(C)C#CCN(C)Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H25N/c1-14(2)7-6-12-18(5)13-16-8-10-17(11-9-16)15(3)4/h8-11,14-15H,12-13H2,1-5H3 |
| InChIKey | GZNOSZOIJYIGFL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|