C23H28N2 — CID 155934628
(1S)-N,N'-dibenzyl-1-cyclopropyl-N,N'-dimethylbut-2-yne-1,4-diamine (PubChem CID 155934628) has the molecular formula C23H28N2 and a molecular weight of 332.49 g/mol. Its IUPAC name is (1S)-N,N'-dibenzyl-1-cyclopropyl-N,N'-dimethylbut-2-yne-1,4-diamine.
| Compound Name | (1S)-N,N'-dibenzyl-1-cyclopropyl-N,N'-dimethylbut-2-yne-1,4-diamine |
|---|---|
| PubChem CID | 155934628 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | (1S)-N,N'-dibenzyl-1-cyclopropyl-N,N'-dimethylbut-2-yne-1,4-diamine |
| SMILES | CN(CC#C[C@H](C1CC1)N(C)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H28N2/c1-24(18-20-10-5-3-6-11-20)17-9-14-23(22-15-16-22)25(2)19-21-12-7-4-8-13-21/h3-8,10-13,22-23H,15-19H2,1-2H3/t23-/m1/s1 |
| InChIKey | BUSNUURIBHVBRO-HSZRJFAPSA-N |
| XLogP | 4.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|