C26H32N2O — CID 70515525
3-[2-[benzyl(methyl)amino]ethyl-methylamino]-1,1-diphenylpropan-1-ol (PubChem CID 70515525) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is 3-[2-[benzyl(methyl)amino]ethyl-methylamino]-1,1-diphenylpropan-1-ol.
| Compound Name | 3-[2-[benzyl(methyl)amino]ethyl-methylamino]-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 70515525 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 3-[2-[benzyl(methyl)amino]ethyl-methylamino]-1,1-diphenylpropan-1-ol |
| SMILES | CN(CCN(C)Cc1ccccc1)CCC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32N2O/c1-27(20-21-28(2)22-23-12-6-3-7-13-23)19-18-26(29,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,29H,18-22H2,1-2H3 |
| InChIKey | ATAAIGDJBWZZDU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |