C22H33NO3S — CID 14985794
[5-(diethylamino)-2-methylpent-3-yn-2-yl] 2-cyclohexyl-2-hydroxy-2-thiophen-2-ylacetate (PubChem CID 14985794) has the molecular formula C22H33NO3S and a molecular weight of 391.58 g/mol. Its IUPAC name is [5-(diethylamino)-2-methylpent-3-yn-2-yl] 2-cyclohexyl-2-hydroxy-2-thiophen-2-ylacetate.
| Compound Name | [5-(diethylamino)-2-methylpent-3-yn-2-yl] 2-cyclohexyl-2-hydroxy-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 14985794 |
| Molecular Formula | C22H33NO3S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | [5-(diethylamino)-2-methylpent-3-yn-2-yl] 2-cyclohexyl-2-hydroxy-2-thiophen-2-ylacetate |
| SMILES | CCN(CC)CC#CC(C)(C)OC(=O)C(O)(c1cccs1)C1CCCCC1 |
| InChI | InChI=1S/C22H33NO3S/c1-5-23(6-2)16-11-15-21(3,4)26-20(24)22(25,19-14-10-17-27-19)18-12-8-7-9-13-18/h10,14,17-18,25H,5-9,12-13,16H2,1-4H3 |
| InChIKey | IHKYGDAWKLFTMZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|