C21H24NO+ — CID 4034233
4-(2-methylpyrrolidin-1-ium-1-yl)-1,1-diphenylbut-2-yn-1-ol (PubChem CID 4034233) has the molecular formula C21H24NO+ and a molecular weight of 306.43 g/mol. Its IUPAC name is 4-(2-methylpyrrolidin-1-ium-1-yl)-1,1-diphenylbut-2-yn-1-ol.
| Compound Name | 4-(2-methylpyrrolidin-1-ium-1-yl)-1,1-diphenylbut-2-yn-1-ol |
|---|---|
| PubChem CID | 4034233 |
| Molecular Formula | C21H24NO+ |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 4-(2-methylpyrrolidin-1-ium-1-yl)-1,1-diphenylbut-2-yn-1-ol |
| SMILES | CC1CCC[NH+]1CC#CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO/c1-18-10-8-16-22(18)17-9-15-21(23,19-11-4-2-5-12-19)20-13-6-3-7-14-20/h2-7,11-14,18,23H,8,10,16-17H2,1H3/p+1 |
| InChIKey | LMEKONRXAOSIGP-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|