C21H28NO+ — CID 7013704
[(2S)-1-butylpyrrolidin-1-ium-2-yl]-diphenylmethanol (PubChem CID 7013704) has the molecular formula C21H28NO+ and a molecular weight of 310.46 g/mol. Its IUPAC name is [(2S)-1-butylpyrrolidin-1-ium-2-yl]-diphenylmethanol.
| Compound Name | [(2S)-1-butylpyrrolidin-1-ium-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 7013704 |
| Molecular Formula | C21H28NO+ |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | [(2S)-1-butylpyrrolidin-1-ium-2-yl]-diphenylmethanol |
| SMILES | CCCC[NH+]1CCC[C@H]1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO/c1-2-3-16-22-17-10-15-20(22)21(23,18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14,20,23H,2-3,10,15-17H2,1H3/p+1/t20-/m0/s1 |
| InChIKey | PFQSSMKHKLCPPA-FQEVSTJZSA-O |
| XLogP | 2.77 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |