C25H28NO2+ — CID 6966373
2-[[4-[hydroxy(diphenyl)methyl]piperidin-1-ium-1-yl]methyl]phenol (PubChem CID 6966373) has the molecular formula C25H28NO2+ and a molecular weight of 374.50 g/mol. Its IUPAC name is 2-[[4-[hydroxy(diphenyl)methyl]piperidin-1-ium-1-yl]methyl]phenol.
| Compound Name | 2-[[4-[hydroxy(diphenyl)methyl]piperidin-1-ium-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 6966373 |
| Molecular Formula | C25H28NO2+ |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-[[4-[hydroxy(diphenyl)methyl]piperidin-1-ium-1-yl]methyl]phenol |
| SMILES | Oc1ccccc1C[NH+]1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H27NO2/c27-24-14-8-7-9-20(24)19-26-17-15-23(16-18-26)25(28,21-10-3-1-4-11-21)22-12-5-2-6-13-22/h1-14,23,27-28H,15-19H2/p+1 |
| InChIKey | BEWKCMFWZLJERS-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|