C27H30NO+ — CID 7385508
[(2S,7R,8aS)-2-phenyl-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-7-yl]-diphenylmethanol (PubChem CID 7385508) has the molecular formula C27H30NO+ and a molecular weight of 384.54 g/mol. Its IUPAC name is [(2S,7R,8aS)-2-phenyl-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-7-yl]-diphenylmethanol.
| Compound Name | [(2S,7R,8aS)-2-phenyl-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-7-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 7385508 |
| Molecular Formula | C27H30NO+ |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [(2S,7R,8aS)-2-phenyl-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-7-yl]-diphenylmethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)[C@@H]1CC[NH+]2C[C@H](c3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C27H29NO/c29-27(23-12-6-2-7-13-23,24-14-8-3-9-15-24)25-16-17-28-20-22(18-26(28)19-25)21-10-4-1-5-11-21/h1-15,22,25-26,29H,16-20H2/p+1/t22-,25-,26+/m1/s1 |
| InChIKey | XSLGPTMCZRXAJH-RCXJIHSJSA-O |
| XLogP | 3.77 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |