C23H23NO — CID 102038889
diphenyl-[(2S,3R)-3-phenylpyrrolidin-2-yl]methanol (PubChem CID 102038889) has the molecular formula C23H23NO and a molecular weight of 329.44 g/mol. Its IUPAC name is diphenyl-[(2S,3R)-3-phenylpyrrolidin-2-yl]methanol.
| Compound Name | diphenyl-[(2S,3R)-3-phenylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 102038889 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | diphenyl-[(2S,3R)-3-phenylpyrrolidin-2-yl]methanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)[C@H]1NCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H23NO/c25-23(19-12-6-2-7-13-19,20-14-8-3-9-15-20)22-21(16-17-24-22)18-10-4-1-5-11-18/h1-15,21-22,24-25H,16-17H2/t21-,22+/m1/s1 |
| InChIKey | URZNDQJMQKBSGZ-YADHBBJMSA-N |
| XLogP | 4.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |