C14H21N — CID 101397684
(2S,3S)-2-(2-methylpropyl)-3-phenylpyrrolidine (PubChem CID 101397684) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (2S,3S)-2-(2-methylpropyl)-3-phenylpyrrolidine.
| Compound Name | (2S,3S)-2-(2-methylpropyl)-3-phenylpyrrolidine |
|---|---|
| PubChem CID | 101397684 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (2S,3S)-2-(2-methylpropyl)-3-phenylpyrrolidine |
| SMILES | CC(C)C[C@@H]1NCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H21N/c1-11(2)10-14-13(8-9-15-14)12-6-4-3-5-7-12/h3-7,11,13-15H,8-10H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | DKZLPNAFISALIE-KBPBESRZSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |