C22H27NO — CID 12519321
[(2R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl]-diphenylmethanol (PubChem CID 12519321) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is [(2R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl]-diphenylmethanol.
| Compound Name | [(2R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 12519321 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | [(2R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl]-diphenylmethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)[C@@H]1CCN2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C22H27NO/c24-22(18-9-3-1-4-10-18,19-11-5-2-6-12-19)20-14-16-23-15-8-7-13-21(23)17-20/h1-6,9-12,20-21,24H,7-8,13-17H2/t20-,21-/m1/s1 |
| InChIKey | UAWNIIAGZSPONT-NHCUHLMSSA-N |
| XLogP | 4.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |