C9H18N2 — CID 12783916
(2S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-amine (PubChem CID 12783916) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (2S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-amine.
| Compound Name | (2S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-amine |
|---|---|
| PubChem CID | 12783916 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (2S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-amine |
| SMILES | N[C@H]1CCN2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C9H18N2/c10-8-4-6-11-5-2-1-3-9(11)7-8/h8-9H,1-7,10H2/t8-,9+/m0/s1 |
| InChIKey | QTYYLKWVPVUNET-DTWKUNHWSA-N |
| XLogP | 0.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |