C21H26NO+ — CID 23245268
2-[(2S,8R)-1,2,3,4,5,6,7,8-octahydropyrrolizin-4-ium-2-yl]-1,1-diphenylethanol (PubChem CID 23245268) has the molecular formula C21H26NO+ and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-[(2S,8R)-1,2,3,4,5,6,7,8-octahydropyrrolizin-4-ium-2-yl]-1,1-diphenylethanol.
| Compound Name | 2-[(2S,8R)-1,2,3,4,5,6,7,8-octahydropyrrolizin-4-ium-2-yl]-1,1-diphenylethanol |
|---|---|
| PubChem CID | 23245268 |
| Molecular Formula | C21H26NO+ |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-[(2S,8R)-1,2,3,4,5,6,7,8-octahydropyrrolizin-4-ium-2-yl]-1,1-diphenylethanol |
| SMILES | OC(C[C@@H]1C[C@H]2CCC[NH+]2C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO/c23-21(18-8-3-1-4-9-18,19-10-5-2-6-11-19)15-17-14-20-12-7-13-22(20)16-17/h1-6,8-11,17,20,23H,7,12-16H2/p+1/t17-,20+/m0/s1 |
| InChIKey | CPWXJGPCILRUJO-FXAWDEMLSA-O |
| XLogP | 2.38 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |