C21H27N2O2+ — CID 6944696
N-benzyl-1-[(2-hydroxyphenyl)methyl]-N-methylpiperidin-1-ium-4-carboxamide (PubChem CID 6944696) has the molecular formula C21H27N2O2+ and a molecular weight of 339.46 g/mol. Its IUPAC name is N-benzyl-1-[(2-hydroxyphenyl)methyl]-N-methylpiperidin-1-ium-4-carboxamide.
| Compound Name | N-benzyl-1-[(2-hydroxyphenyl)methyl]-N-methylpiperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6944696 |
| Molecular Formula | C21H27N2O2+ |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | N-benzyl-1-[(2-hydroxyphenyl)methyl]-N-methylpiperidin-1-ium-4-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C1CC[NH+](Cc2ccccc2O)CC1 |
| InChI | InChI=1S/C21H26N2O2/c1-22(15-17-7-3-2-4-8-17)21(25)18-11-13-23(14-12-18)16-19-9-5-6-10-20(19)24/h2-10,18,24H,11-16H2,1H3/p+1 |
| InChIKey | MCGVPIBAWMASDR-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 44.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|